C19H20O3 — CID 162851679
4-methoxy-5,11,11-trimethyltetracyclo[7.6.0.02,7.010,15]pentadeca-2(7),3,5,10(15)-tetraene-8,14-dione (PubChem CID 162851679) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-methoxy-5,11,11-trimethyltetracyclo[7.6.0.02,7.010,15]pentadeca-2(7),3,5,10(15)-tetraene-8,14-dione.
| Compound Name | 4-methoxy-5,11,11-trimethyltetracyclo[7.6.0.02,7.010,15]pentadeca-2(7),3,5,10(15)-tetraene-8,14-dione |
|---|---|
| PubChem CID | 162851679 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-methoxy-5,11,11-trimethyltetracyclo[7.6.0.02,7.010,15]pentadeca-2(7),3,5,10(15)-tetraene-8,14-dione |
| SMILES | COc1cc2c(cc1C)C(=O)C1C3=C(C(=O)CCC3(C)C)C21 |
| InChI | InChI=1S/C19H20O3/c1-9-7-11-10(8-13(9)22-4)14-15-12(20)5-6-19(2,3)17(15)16(14)18(11)21/h7-8,14,16H,5-6H2,1-4H3 |
| InChIKey | MFDIRQZUSKKMNW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |