C12H14O2 — CID 102352796
(4S)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one (PubChem CID 102352796) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (4S)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one.
| Compound Name | (4S)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 102352796 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (4S)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one |
| SMILES | Cc1ccc2c(c1)C(=O)CC[C@]2(C)O |
| InChI | InChI=1S/C12H14O2/c1-8-3-4-10-9(7-8)11(13)5-6-12(10,2)14/h3-4,7,14H,5-6H2,1-2H3/t12-/m0/s1 |
| InChIKey | UUVVPOMHZJKZSI-LBPRGKRZSA-N |
| XLogP | 2.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |