C24H22O3 — CID 21217157
methyl 4-(5,5-dimethyl-8-oxo-6,7-dihydroanthracen-2-yl)benzoate (PubChem CID 21217157) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 4-(5,5-dimethyl-8-oxo-6,7-dihydroanthracen-2-yl)benzoate.
| Compound Name | methyl 4-(5,5-dimethyl-8-oxo-6,7-dihydroanthracen-2-yl)benzoate |
|---|---|
| PubChem CID | 21217157 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | methyl 4-(5,5-dimethyl-8-oxo-6,7-dihydroanthracen-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3cc4c(cc3c2)C(=O)CCC4(C)C)cc1 |
| InChI | InChI=1S/C24H22O3/c1-24(2)11-10-22(25)20-13-19-12-17(8-9-18(19)14-21(20)24)15-4-6-16(7-5-15)23(26)27-3/h4-9,12-14H,10-11H2,1-3H3 |
| InChIKey | KQPLBYZXWQXIQS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |