C30H30O2 — CID 21217163
methyl 4-[8-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate (PubChem CID 21217163) has the molecular formula C30H30O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 4-[8-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate.
| Compound Name | methyl 4-[8-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate |
|---|---|
| PubChem CID | 21217163 |
| Molecular Formula | C30H30O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | methyl 4-[8-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3cc4c(cc3c2)C(C#CC(C)(C)C)=CCC4(C)C)cc1 |
| InChI | InChI=1S/C30H30O2/c1-29(2,3)15-13-21-14-16-30(4,5)27-19-24-12-11-23(17-25(24)18-26(21)27)20-7-9-22(10-8-20)28(31)32-6/h7-12,14,17-19H,16H2,1-6H3 |
| InChIKey | QQURUUWJZYNATO-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|