C31H28O3 — CID 21217156
methyl 4-[8-(4-methoxyphenyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate (PubChem CID 21217156) has the molecular formula C31H28O3 and a molecular weight of 448.56 g/mol. Its IUPAC name is methyl 4-[8-(4-methoxyphenyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate.
| Compound Name | methyl 4-[8-(4-methoxyphenyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate |
|---|---|
| PubChem CID | 21217156 |
| Molecular Formula | C31H28O3 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl 4-[8-(4-methoxyphenyl)-5,5-dimethyl-6H-anthracen-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3cc4c(cc3c2)C(c2ccc(OC)cc2)=CCC4(C)C)cc1 |
| InChI | InChI=1S/C31H28O3/c1-31(2)16-15-27(21-11-13-26(33-3)14-12-21)28-18-25-17-23(9-10-24(25)19-29(28)31)20-5-7-22(8-6-20)30(32)34-4/h5-15,17-19H,16H2,1-4H3 |
| InChIKey | UYSDBRLNAOBLAY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |