C9H11NO2S — CID 21300229
3,3-dimethyl-2H-thieno[2,3-c]pyridine 1,1-dioxide (PubChem CID 21300229) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 3,3-dimethyl-2H-thieno[2,3-c]pyridine 1,1-dioxide.
| Compound Name | 3,3-dimethyl-2H-thieno[2,3-c]pyridine 1,1-dioxide |
|---|---|
| PubChem CID | 21300229 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 3,3-dimethyl-2H-thieno[2,3-c]pyridine 1,1-dioxide |
| SMILES | CC1(C)CS(=O)(=O)c2cnccc21 |
| InChI | InChI=1S/C9H11NO2S/c1-9(2)6-13(11,12)8-5-10-4-3-7(8)9/h3-5H,6H2,1-2H3 |
| InChIKey | KUWLACJAEMDDOO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |