C9H11NOS — CID 21300225
3,3-dimethyl-2H-thieno[3,2-c]pyridine 1-oxide (PubChem CID 21300225) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 3,3-dimethyl-2H-thieno[3,2-c]pyridine 1-oxide.
| Compound Name | 3,3-dimethyl-2H-thieno[3,2-c]pyridine 1-oxide |
|---|---|
| PubChem CID | 21300225 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 3,3-dimethyl-2H-thieno[3,2-c]pyridine 1-oxide |
| SMILES | CC1(C)CS(=O)c2ccncc21 |
| InChI | InChI=1S/C9H11NOS/c1-9(2)6-12(11)8-3-4-10-5-7(8)9/h3-5H,6H2,1-2H3 |
| InChIKey | DURHNYPWKVHHKE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |