C7H5N3O — CID 45080248
pyrimido[4,5-b][1,4]oxazepine (PubChem CID 45080248) has the molecular formula C7H5N3O and a molecular weight of 147.14 g/mol. Its IUPAC name is pyrimido[4,5-b][1,4]oxazepine.
| Compound Name | pyrimido[4,5-b][1,4]oxazepine |
|---|---|
| PubChem CID | 45080248 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | pyrimido[4,5-b][1,4]oxazepine |
| SMILES | C1=COc2ncncc2N=C1 |
| InChI | InChI=1S/C7H5N3O/c1-2-9-6-4-8-5-10-7(6)11-3-1/h1-5H |
| InChIKey | SHQVWBZVMFPCFZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |