About 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one
2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 175727554) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one.
Analyze 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one?
The IUPAC name of 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one (CID 175727554) is 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one.
What is the SMILES notation for 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one?
The canonical SMILES for 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one is CC1NC(=O)c2cncnc2O1.
What is the InChIKey of 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one?
The InChIKey is RKHLTCHTDQYCMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-4-10-6(11)5-2-8-3-9-7(5)12-4/h2-4H,1H3,(H,10,11).
What are the key properties of 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one?
2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one has a molecular weight of 165.15 g/mol, XLogP of -0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one is sourced from PubChem (CID 175727554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).