C8H9N3O3S — CID 21300105
8,8-dimethyl-7,7-dioxopyrimido[5,4-d]thiazin-5-one (PubChem CID 21300105) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is 8,8-dimethyl-7,7-dioxopyrimido[5,4-d]thiazin-5-one.
| Compound Name | 8,8-dimethyl-7,7-dioxopyrimido[5,4-d]thiazin-5-one |
|---|---|
| PubChem CID | 21300105 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 8,8-dimethyl-7,7-dioxopyrimido[5,4-d]thiazin-5-one |
| SMILES | CC1(C)c2ncncc2C(=O)NS1(=O)=O |
| InChI | InChI=1S/C8H9N3O3S/c1-8(2)6-5(3-9-4-10-6)7(12)11-15(8,13)14/h3-4H,1-2H3,(H,11,12) |
| InChIKey | RVACOQDOFUDOEO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |