C8H12N4 — CID 143903022
ethane;3-methyl-2H-pyrazolo[4,3-d]pyrimidine (PubChem CID 143903022) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is ethane;3-methyl-2H-pyrazolo[4,3-d]pyrimidine.
| Compound Name | ethane;3-methyl-2H-pyrazolo[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 143903022 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | ethane;3-methyl-2H-pyrazolo[4,3-d]pyrimidine |
| SMILES | CC.Cc1[nH]nc2cncnc12 |
| InChI | InChI=1S/C6H6N4.C2H6/c1-4-6-5(10-9-4)2-7-3-8-6;1-2/h2-3H,1H3,(H,9,10);1-2H3 |
| InChIKey | DAUVQZOTWRVOGM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |