C7H6N2O — CID 66624036
6H-pyrano[3,2-d]pyrimidine (PubChem CID 66624036) has the molecular formula C7H6N2O and a molecular weight of 134.14 g/mol. Its IUPAC name is 6H-pyrano[3,2-d]pyrimidine.
| Compound Name | 6H-pyrano[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 66624036 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 6H-pyrano[3,2-d]pyrimidine |
| SMILES | C1=Cc2ncncc2OC1 |
| InChI | InChI=1S/C7H6N2O/c1-2-6-7(10-3-1)4-8-5-9-6/h1-2,4-5H,3H2 |
| InChIKey | LXJWTBIPBFBGFV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |