C5H4N2O2 — CID 87084704
3H-dioxolo[4,3-d]pyrimidine (PubChem CID 87084704) has the molecular formula C5H4N2O2 and a molecular weight of 124.10 g/mol. Its IUPAC name is 3H-dioxolo[4,3-d]pyrimidine.
| Compound Name | 3H-dioxolo[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 87084704 |
| Molecular Formula | C5H4N2O2 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 3H-dioxolo[4,3-d]pyrimidine |
| SMILES | c1ncc2c(n1)COO2 |
| InChI | InChI=1S/C5H4N2O2/c1-5-4(2-8-9-5)7-3-6-1/h1,3H,2H2 |
| InChIKey | RGLUYOHPCGXAGN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|