C6H7N2O3P — CID 166551777
2-methyl-4H-[1,3,2]dioxaphosphinino[5,4-d]pyrimidine 2-oxide (PubChem CID 166551777) has the molecular formula C6H7N2O3P and a molecular weight of 186.11 g/mol. Its IUPAC name is 2-methyl-4H-[1,3,2]dioxaphosphinino[5,4-d]pyrimidine 2-oxide.
| Compound Name | 2-methyl-4H-[1,3,2]dioxaphosphinino[5,4-d]pyrimidine 2-oxide |
|---|---|
| PubChem CID | 166551777 |
| Molecular Formula | C6H7N2O3P |
| Molecular Weight | 186.11 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 2-methyl-4H-[1,3,2]dioxaphosphinino[5,4-d]pyrimidine 2-oxide |
| SMILES | CP1(=O)OCc2ncncc2O1 |
| InChI | InChI=1S/C6H7N2O3P/c1-12(9)10-3-5-6(11-12)2-7-4-8-5/h2,4H,3H2,1H3 |
| InChIKey | VDMCWRGVDZLRNR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.11 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|