About 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate
2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate (PubChem CID 174493888) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate.
Molecular Properties
| Compound Name | 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate |
| PubChem CID | 174493888 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate |
| SMILES | COC(C)=O.c1ncc2c(n1)C2 |
| InChI | InChI=1S/C5H4N2.C3H6O2/c1-4-2-6-3-7-5(1)4;1-3(4)5-2/h2-3H,1H2;1-2H3 |
| InChIKey | DRRQXOALIZAFTC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate?
The IUPAC name of 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate (CID 174493888) is 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate.
What is the SMILES notation for 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate?
The canonical SMILES for 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate is COC(C)=O.c1ncc2c(n1)C2.
What is the InChIKey of 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate?
The InChIKey is DRRQXOALIZAFTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2.C3H6O2/c1-4-2-6-3-7-5(1)4;1-3(4)5-2/h2-3H,1H2;1-2H3.
What are the key properties of 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate?
2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate has a molecular weight of 166.18 g/mol, XLogP of 0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene;methyl acetate is sourced from PubChem (CID 174493888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).