About ethane;5-methylidene-7,8-dihydro-6H-quinazoline
ethane;5-methylidene-7,8-dihydro-6H-quinazoline (PubChem CID 143340702) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;5-methylidene-7,8-dihydro-6H-quinazoline.
Molecular Properties
| Compound Name | ethane;5-methylidene-7,8-dihydro-6H-quinazoline |
| PubChem CID | 143340702 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | ethane;5-methylidene-7,8-dihydro-6H-quinazoline |
| SMILES | C=C1CCCc2ncncc21.CC.CC |
| InChI | InChI=1S/C9H10N2.2C2H6/c1-7-3-2-4-9-8(7)5-10-6-11-9;2*1-2/h5-6H,1-4H2;2*1-2H3 |
| InChIKey | TWEJLEICKNCMAU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-methylidene-7,8-dihydro-6H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylidene-7,8-dihydro-6H-quinazoline?
The IUPAC name of ethane;5-methylidene-7,8-dihydro-6H-quinazoline (CID 143340702) is ethane;5-methylidene-7,8-dihydro-6H-quinazoline.
What is the SMILES notation for ethane;5-methylidene-7,8-dihydro-6H-quinazoline?
The canonical SMILES for ethane;5-methylidene-7,8-dihydro-6H-quinazoline is C=C1CCCc2ncncc21.CC.CC.
What is the InChIKey of ethane;5-methylidene-7,8-dihydro-6H-quinazoline?
The InChIKey is TWEJLEICKNCMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.2C2H6/c1-7-3-2-4-9-8(7)5-10-6-11-9;2*1-2/h5-6H,1-4H2;2*1-2H3.
What are the key properties of ethane;5-methylidene-7,8-dihydro-6H-quinazoline?
ethane;5-methylidene-7,8-dihydro-6H-quinazoline has a molecular weight of 206.33 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylidene-7,8-dihydro-6H-quinazoline is sourced from PubChem (CID 143340702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).