C10H17N3 — CID 143904281
ethane;5-ethyl-6,7-dihydropyrrolo[3,2-d]pyrimidine (PubChem CID 143904281) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is ethane;5-ethyl-6,7-dihydropyrrolo[3,2-d]pyrimidine.
| Compound Name | ethane;5-ethyl-6,7-dihydropyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 143904281 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | ethane;5-ethyl-6,7-dihydropyrrolo[3,2-d]pyrimidine |
| SMILES | CC.CCN1CCc2ncncc21 |
| InChI | InChI=1S/C8H11N3.C2H6/c1-2-11-4-3-7-8(11)5-9-6-10-7;1-2/h5-6H,2-4H2,1H3;1-2H3 |
| InChIKey | KVGSEYHLUXCUSC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |