C9H13N3 — CID 138607465
5-propan-2-yl-6,7-dihydropyrrolo[3,2-d]pyrimidine (PubChem CID 138607465) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-propan-2-yl-6,7-dihydropyrrolo[3,2-d]pyrimidine.
| Compound Name | 5-propan-2-yl-6,7-dihydropyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 138607465 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-propan-2-yl-6,7-dihydropyrrolo[3,2-d]pyrimidine |
| SMILES | CC(C)N1CCc2ncncc21 |
| InChI | InChI=1S/C9H13N3/c1-7(2)12-4-3-8-9(12)5-10-6-11-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | ABXIGOXZKPTLNN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |