C11H14NY- — CID 170523083
1-propan-2-yl-3,5-dihydro-2H-indol-5-ide;yttrium (PubChem CID 170523083) has the molecular formula C11H14NY- and a molecular weight of 249.15 g/mol. Its IUPAC name is 1-propan-2-yl-3,5-dihydro-2H-indol-5-ide;yttrium.
| Compound Name | 1-propan-2-yl-3,5-dihydro-2H-indol-5-ide;yttrium |
|---|---|
| PubChem CID | 170523083 |
| Molecular Formula | C11H14NY- |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 1-propan-2-yl-3,5-dihydro-2H-indol-5-ide;yttrium |
| SMILES | CC(C)N1CCc2c[c-]ccc21.[Y] |
| InChI | InChI=1S/C11H14N.Y/c1-9(2)12-8-7-10-5-3-4-6-11(10)12;/h4-6,9H,7-8H2,1-2H3;/q-1; |
| InChIKey | QJHPRCGHZLWMSE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|