C10H13NOS — CID 130067236
6-propan-2-yl-4,5-dihydrothieno[2,3-c]pyridin-7-one (PubChem CID 130067236) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 6-propan-2-yl-4,5-dihydrothieno[2,3-c]pyridin-7-one.
| Compound Name | 6-propan-2-yl-4,5-dihydrothieno[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 130067236 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 6-propan-2-yl-4,5-dihydrothieno[2,3-c]pyridin-7-one |
| SMILES | CC(C)N1CCc2ccsc2C1=O |
| InChI | InChI=1S/C10H13NOS/c1-7(2)11-5-3-8-4-6-13-9(8)10(11)12/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | SJFOYYUZNUEBCY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |