C12H15NO2 — CID 84673185
7-hydroxy-2-propan-2-yl-3,4-dihydroisoquinolin-1-one (PubChem CID 84673185) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 7-hydroxy-2-propan-2-yl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-hydroxy-2-propan-2-yl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 84673185 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 7-hydroxy-2-propan-2-yl-3,4-dihydroisoquinolin-1-one |
| SMILES | CC(C)N1CCc2ccc(O)cc2C1=O |
| InChI | InChI=1S/C12H15NO2/c1-8(2)13-6-5-9-3-4-10(14)7-11(9)12(13)15/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | SDTQNFDPOSUZML-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |