C11H15N — CID 166586860
1-propan-2-yl-6-tritio-2,3-dihydroindole (PubChem CID 166586860) has the molecular formula C11H15N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-propan-2-yl-6-tritio-2,3-dihydroindole.
| Compound Name | 1-propan-2-yl-6-tritio-2,3-dihydroindole |
|---|---|
| PubChem CID | 166586860 |
| Molecular Formula | C11H15N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.13 |
| IUPAC Name | 1-propan-2-yl-6-tritio-2,3-dihydroindole |
| SMILES | [3H]c1ccc2c(c1)N(C(C)C)CC2 |
| InChI | InChI=1S/C11H15N/c1-9(2)12-8-7-10-5-3-4-6-11(10)12/h3-6,9H,7-8H2,1-2H3/i4T |
| InChIKey | KCNSXRWYZKXRLP-IBTRZKOZSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |