C16H25N3OS — CID 170221851
N-[2-(2,3-dihydroindol-1-yl)propyl]piperidine-1-sulfinamide (PubChem CID 170221851) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)propyl]piperidine-1-sulfinamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)propyl]piperidine-1-sulfinamide |
|---|---|
| PubChem CID | 170221851 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)propyl]piperidine-1-sulfinamide |
| SMILES | CC(CNS(=O)N1CCCCC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H25N3OS/c1-14(13-17-21(20)18-10-5-2-6-11-18)19-12-9-15-7-3-4-8-16(15)19/h3-4,7-8,14,17H,2,5-6,9-13H2,1H3 |
| InChIKey | VYLASFQHRAITPX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |