C13H21N3S — CID 170221823
2-(2,3-dihydroindol-1-yl)-N-(dimethylaminosulfanyl)propan-1-amine (PubChem CID 170221823) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N-(dimethylaminosulfanyl)propan-1-amine.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N-(dimethylaminosulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 170221823 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N-(dimethylaminosulfanyl)propan-1-amine |
| SMILES | CC(CNSN(C)C)N1CCc2ccccc21 |
| InChI | InChI=1S/C13H21N3S/c1-11(10-14-17-15(2)3)16-9-8-12-6-4-5-7-13(12)16/h4-7,11,14H,8-10H2,1-3H3 |
| InChIKey | QBUBPNKHRIAGGY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|