About 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride
4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride (PubChem CID 120564829) has the molecular formula C16H27Cl2N3O
and a molecular weight of 348.32 g/mol. Its IUPAC name is 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride.
Molecular Properties
| Compound Name | 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride |
| PubChem CID | 120564829 |
| Molecular Formula | C16H27Cl2N3O |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCC(C)N1CCc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C16H25N3O.2ClH/c1-12(17)7-8-16(20)18-11-13(2)19-10-9-14-5-3-4-6-15(14)19;;/h3-6,12-13H,7-11,17H2,1-2H3,(H,18,20);2*1H |
| InChIKey | TVYYZBHTEJARBC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride?
The IUPAC name of 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride (CID 120564829) is 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride.
What is the SMILES notation for 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride?
The canonical SMILES for 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride is CC(N)CCC(=O)NCC(C)N1CCc2ccccc21.Cl.Cl.
What is the InChIKey of 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride?
The InChIKey is TVYYZBHTEJARBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O.2ClH/c1-12(17)7-8-16(20)18-11-13(2)19-10-9-14-5-3-4-6-15(14)19;;/h3-6,12-13H,7-11,17H2,1-2H3,(H,18,20);2*1H.
What are the key properties of 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride?
4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride has a molecular weight of 348.32 g/mol, XLogP of 2.52, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]pentanamide;dihydrochloride is sourced from PubChem (CID 120564829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).