C20H25N3O — CID 120565087
4-amino-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]pentanamide (PubChem CID 120565087) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-amino-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]pentanamide.
| Compound Name | 4-amino-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 120565087 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-amino-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]pentanamide |
| SMILES | CC(N)CCC(=O)Nc1ccc(CN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-15(21)6-11-20(24)22-18-9-7-16(8-10-18)14-23-13-12-17-4-2-3-5-19(17)23/h2-5,7-10,15H,6,11-14,21H2,1H3,(H,22,24) |
| InChIKey | FRQJURBCQDZDSY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |