C20H25N3O2 — CID 110895780
1-[2-(2,3-dihydroindol-1-yl)propyl]-3-(2-hydroxy-1-phenylethyl)urea (PubChem CID 110895780) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)propyl]-3-(2-hydroxy-1-phenylethyl)urea.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)propyl]-3-(2-hydroxy-1-phenylethyl)urea |
|---|---|
| PubChem CID | 110895780 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)propyl]-3-(2-hydroxy-1-phenylethyl)urea |
| SMILES | CC(CNC(=O)NC(CO)c1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H25N3O2/c1-15(23-12-11-17-9-5-6-10-19(17)23)13-21-20(25)22-18(14-24)16-7-3-2-4-8-16/h2-10,15,18,24H,11-14H2,1H3,(H2,21,22,25) |
| InChIKey | GSVLRXVKICXGAI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |