C18H25N3O2 — CID 111630627
1-[2-(2,3-dihydroindol-1-yl)propyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 111630627) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)propyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)propyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 111630627 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)propyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | CC(CNC(=O)N[C@@H]1C=C[C@H](CO)C1)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H25N3O2/c1-13(21-9-8-15-4-2-3-5-17(15)21)11-19-18(23)20-16-7-6-14(10-16)12-22/h2-7,13-14,16,22H,8-12H2,1H3,(H2,19,20,23)/t13?,14-,16+/m0/s1 |
| InChIKey | IECZTOHTIGDZAF-JGKCFBKVSA-N |
| XLogP | 1.67 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|