C18H26N4O2 — CID 94030578
1-[(2S)-2-(2,3-dihydroindol-1-yl)propyl]-3-[(3S)-2-oxoazepan-3-yl]urea (PubChem CID 94030578) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(2S)-2-(2,3-dihydroindol-1-yl)propyl]-3-[(3S)-2-oxoazepan-3-yl]urea.
| Compound Name | 1-[(2S)-2-(2,3-dihydroindol-1-yl)propyl]-3-[(3S)-2-oxoazepan-3-yl]urea |
|---|---|
| PubChem CID | 94030578 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-[(2S)-2-(2,3-dihydroindol-1-yl)propyl]-3-[(3S)-2-oxoazepan-3-yl]urea |
| SMILES | C[C@@H](CNC(=O)N[C@H]1CCCCNC1=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H26N4O2/c1-13(22-11-9-14-6-2-3-8-16(14)22)12-20-18(24)21-15-7-4-5-10-19-17(15)23/h2-3,6,8,13,15H,4-5,7,9-12H2,1H3,(H,19,23)(H2,20,21,24)/t13-,15-/m0/s1 |
| InChIKey | FPDZBHUPIMZEBO-ZFWWWQNUSA-N |
| XLogP | 1.41 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |