C21H23N3O2 — CID 95326856
(2S)-2-(2,3-dihydroindol-1-yl)-N-[(3S)-2-oxopiperidin-3-yl]-2-phenylacetamide (PubChem CID 95326856) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydroindol-1-yl)-N-[(3S)-2-oxopiperidin-3-yl]-2-phenylacetamide.
| Compound Name | (2S)-2-(2,3-dihydroindol-1-yl)-N-[(3S)-2-oxopiperidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 95326856 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (2S)-2-(2,3-dihydroindol-1-yl)-N-[(3S)-2-oxopiperidin-3-yl]-2-phenylacetamide |
| SMILES | O=C1NCCC[C@@H]1NC(=O)[C@H](c1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H23N3O2/c25-20-17(10-6-13-22-20)23-21(26)19(16-8-2-1-3-9-16)24-14-12-15-7-4-5-11-18(15)24/h1-5,7-9,11,17,19H,6,10,12-14H2,(H,22,25)(H,23,26)/t17-,19-/m0/s1 |
| InChIKey | XYOGGNISMNQLLC-HKUYNNGSSA-N |
| XLogP | 2.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |