C19H21N3O2 — CID 122143195
3-[[2-(2,3-dihydroindol-1-yl)-2-phenylacetyl]amino]propanamide (PubChem CID 122143195) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[[2-(2,3-dihydroindol-1-yl)-2-phenylacetyl]amino]propanamide.
| Compound Name | 3-[[2-(2,3-dihydroindol-1-yl)-2-phenylacetyl]amino]propanamide |
|---|---|
| PubChem CID | 122143195 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-[[2-(2,3-dihydroindol-1-yl)-2-phenylacetyl]amino]propanamide |
| SMILES | NC(=O)CCNC(=O)C(c1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H21N3O2/c20-17(23)10-12-21-19(24)18(15-7-2-1-3-8-15)22-13-11-14-6-4-5-9-16(14)22/h1-9,18H,10-13H2,(H2,20,23)(H,21,24) |
| InChIKey | LLUFGXSZNNNXPC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |