C19H20N2O4 — CID 25001016
methyl (4R)-4-(2,3-dihydroindol-1-yl)-2-nitro-4-phenylbutanoate (PubChem CID 25001016) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl (4R)-4-(2,3-dihydroindol-1-yl)-2-nitro-4-phenylbutanoate.
| Compound Name | methyl (4R)-4-(2,3-dihydroindol-1-yl)-2-nitro-4-phenylbutanoate |
|---|---|
| PubChem CID | 25001016 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl (4R)-4-(2,3-dihydroindol-1-yl)-2-nitro-4-phenylbutanoate |
| SMILES | COC(=O)C(C[C@H](c1ccccc1)N1CCc2ccccc21)[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N2O4/c1-25-19(22)18(21(23)24)13-17(14-7-3-2-4-8-14)20-12-11-15-9-5-6-10-16(15)20/h2-10,17-18H,11-13H2,1H3/t17-,18?/m1/s1 |
| InChIKey | KQAMHZWHRMQGRK-QNSVNVJESA-N |
| XLogP | 3.00 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|