C17H18N2S — CID 62779934
3-(2,3-dihydroindol-1-yl)-3-phenylpropanethioamide (PubChem CID 62779934) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-3-phenylpropanethioamide.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-3-phenylpropanethioamide |
|---|---|
| PubChem CID | 62779934 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-3-phenylpropanethioamide |
| SMILES | NC(=S)CC(c1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H18N2S/c18-17(20)12-16(13-6-2-1-3-7-13)19-11-10-14-8-4-5-9-15(14)19/h1-9,16H,10-12H2,(H2,18,20) |
| InChIKey | CWEHHINURQFMDH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|