C18H23Cl2N3O — CID 119946701
2-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]benzamide;dihydrochloride (PubChem CID 119946701) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is 2-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946701 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-amino-N-[2-(2,3-dihydroindol-1-yl)propyl]benzamide;dihydrochloride |
| SMILES | CC(CNC(=O)c1ccccc1N)N1CCc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C18H21N3O.2ClH/c1-13(21-11-10-14-6-2-5-9-17(14)21)12-20-18(22)15-7-3-4-8-16(15)19;;/h2-9,13H,10-12,19H2,1H3,(H,20,22);2*1H |
| InChIKey | PBPUYDPNUGMPQU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|