C16H25N3O3 — CID 87003592
1-(2-hydroxy-1-phenylethyl)-3-(2-morpholin-4-ylpropyl)urea (PubChem CID 87003592) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(2-hydroxy-1-phenylethyl)-3-(2-morpholin-4-ylpropyl)urea.
| Compound Name | 1-(2-hydroxy-1-phenylethyl)-3-(2-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 87003592 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-(2-hydroxy-1-phenylethyl)-3-(2-morpholin-4-ylpropyl)urea |
| SMILES | CC(CNC(=O)NC(CO)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C16H25N3O3/c1-13(19-7-9-22-10-8-19)11-17-16(21)18-15(12-20)14-5-3-2-4-6-14/h2-6,13,15,20H,7-12H2,1H3,(H2,17,18,21) |
| InChIKey | WILUMYRAHWKCGQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |