C15H28N4O3 — CID 95352105
1-[(2R)-2-morpholin-4-ylpropyl]-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]urea (PubChem CID 95352105) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[(2R)-2-morpholin-4-ylpropyl]-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]urea.
| Compound Name | 1-[(2R)-2-morpholin-4-ylpropyl]-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 95352105 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[(2R)-2-morpholin-4-ylpropyl]-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]urea |
| SMILES | C[C@H](NC(=O)NC[C@@H](C)N1CCOCC1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C15H28N4O3/c1-12(18-7-9-22-10-8-18)11-16-15(21)17-13(2)14(20)19-5-3-4-6-19/h12-13H,3-11H2,1-2H3,(H2,16,17,21)/t12-,13+/m1/s1 |
| InChIKey | VGZXUBOQIBZBAD-OLZOCXBDSA-N |
| XLogP | 0.02 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |