C12H19N3 — CID 121384005
3,5-di(propan-2-yl)-6,7-dihydropyrrolo[2,3-b]pyrazine (PubChem CID 121384005) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-6,7-dihydropyrrolo[2,3-b]pyrazine.
| Compound Name | 3,5-di(propan-2-yl)-6,7-dihydropyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 121384005 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3,5-di(propan-2-yl)-6,7-dihydropyrrolo[2,3-b]pyrazine |
| SMILES | CC(C)c1cnc2c(n1)N(C(C)C)CC2 |
| InChI | InChI=1S/C12H19N3/c1-8(2)11-7-13-10-5-6-15(9(3)4)12(10)14-11/h7-9H,5-6H2,1-4H3 |
| InChIKey | FNGGNXIGTFHDIW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |