About 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline
5-propan-2-yl-5,6,7,8-tetrahydroquinazoline (PubChem CID 58752884) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline.
Molecular Properties
| Compound Name | 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline |
| PubChem CID | 58752884 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline |
| SMILES | CC(C)C1CCCc2ncncc21 |
| InChI | InChI=1S/C11H16N2/c1-8(2)9-4-3-5-11-10(9)6-12-7-13-11/h6-9H,3-5H2,1-2H3 |
| InChIKey | KMZAHYHFXIKULI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline?
The IUPAC name of 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline (CID 58752884) is 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline.
What is the SMILES notation for 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline?
The canonical SMILES for 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline is CC(C)C1CCCc2ncncc21.
What is the InChIKey of 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline?
The InChIKey is KMZAHYHFXIKULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-8(2)9-4-3-5-11-10(9)6-12-7-13-11/h6-9H,3-5H2,1-2H3.
What are the key properties of 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline?
5-propan-2-yl-5,6,7,8-tetrahydroquinazoline has a molecular weight of 176.26 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-5,6,7,8-tetrahydroquinazoline is sourced from PubChem (CID 58752884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).