C12H17NO — CID 59678208
4-ethoxy-1-ethyl-2,3-dihydroindole (PubChem CID 59678208) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-ethoxy-1-ethyl-2,3-dihydroindole.
| Compound Name | 4-ethoxy-1-ethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 59678208 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-ethoxy-1-ethyl-2,3-dihydroindole |
| SMILES | CCOc1cccc2c1CCN2CC |
| InChI | InChI=1S/C12H17NO/c1-3-13-9-8-10-11(13)6-5-7-12(10)14-4-2/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | NAYXDUJHNMQRQL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |