C11H15NO2 — CID 146317984
4-(methoxymethoxy)-1-methyl-2,3-dihydroindole (PubChem CID 146317984) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(methoxymethoxy)-1-methyl-2,3-dihydroindole.
| Compound Name | 4-(methoxymethoxy)-1-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 146317984 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(methoxymethoxy)-1-methyl-2,3-dihydroindole |
| SMILES | COCOc1cccc2c1CCN2C |
| InChI | InChI=1S/C11H15NO2/c1-12-7-6-9-10(12)4-3-5-11(9)14-8-13-2/h3-5H,6-8H2,1-2H3 |
| InChIKey | XUESQRGNZPMRBT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|