C14H20N2 — CID 146317920
1-methyl-4-(pyrrolidin-1-ylmethyl)-2,3-dihydroindole (PubChem CID 146317920) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-methyl-4-(pyrrolidin-1-ylmethyl)-2,3-dihydroindole.
| Compound Name | 1-methyl-4-(pyrrolidin-1-ylmethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 146317920 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-methyl-4-(pyrrolidin-1-ylmethyl)-2,3-dihydroindole |
| SMILES | CN1CCc2c(CN3CCCC3)cccc21 |
| InChI | InChI=1S/C14H20N2/c1-15-10-7-13-12(5-4-6-14(13)15)11-16-8-2-3-9-16/h4-6H,2-3,7-11H2,1H3 |
| InChIKey | NXFSICHGFMVZBV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |