C11H16N2 — CID 83852967
1-methyl-2,3,4,5-tetrahydro-1-benzazepin-6-amine (PubChem CID 83852967) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-methyl-2,3,4,5-tetrahydro-1-benzazepin-6-amine.
| Compound Name | 1-methyl-2,3,4,5-tetrahydro-1-benzazepin-6-amine |
|---|---|
| PubChem CID | 83852967 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-methyl-2,3,4,5-tetrahydro-1-benzazepin-6-amine |
| SMILES | CN1CCCCc2c(N)cccc21 |
| InChI | InChI=1S/C11H16N2/c1-13-8-3-2-5-9-10(12)6-4-7-11(9)13/h4,6-7H,2-3,5,8,12H2,1H3 |
| InChIKey | YTSWGOOOIPRPNF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|