About 1-butyl-3,4-dihydro-2H-quinolin-5-amine
1-butyl-3,4-dihydro-2H-quinolin-5-amine (PubChem CID 60972612) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-butyl-3,4-dihydro-2H-quinolin-5-amine.
Molecular Properties
| Compound Name | 1-butyl-3,4-dihydro-2H-quinolin-5-amine |
| PubChem CID | 60972612 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-butyl-3,4-dihydro-2H-quinolin-5-amine |
| SMILES | CCCCN1CCCc2c(N)cccc21 |
| InChI | InChI=1S/C13H20N2/c1-2-3-9-15-10-5-6-11-12(14)7-4-8-13(11)15/h4,7-8H,2-3,5-6,9-10,14H2,1H3 |
| InChIKey | MDQGJIBKVOSMSS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3,4-dihydro-2H-quinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,4-dihydro-2H-quinolin-5-amine?
The IUPAC name of 1-butyl-3,4-dihydro-2H-quinolin-5-amine (CID 60972612) is 1-butyl-3,4-dihydro-2H-quinolin-5-amine.
What is the SMILES notation for 1-butyl-3,4-dihydro-2H-quinolin-5-amine?
The canonical SMILES for 1-butyl-3,4-dihydro-2H-quinolin-5-amine is CCCCN1CCCc2c(N)cccc21.
What is the InChIKey of 1-butyl-3,4-dihydro-2H-quinolin-5-amine?
The InChIKey is MDQGJIBKVOSMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-2-3-9-15-10-5-6-11-12(14)7-4-8-13(11)15/h4,7-8H,2-3,5-6,9-10,14H2,1H3.
What are the key properties of 1-butyl-3,4-dihydro-2H-quinolin-5-amine?
1-butyl-3,4-dihydro-2H-quinolin-5-amine has a molecular weight of 204.32 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,4-dihydro-2H-quinolin-5-amine is sourced from PubChem (CID 60972612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).