C14H21N3O — CID 60972396
3-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylpropanamide (PubChem CID 60972396) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylpropanamide.
| Compound Name | 3-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60972396 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCN1CCCc2c(N)cccc21 |
| InChI | InChI=1S/C14H21N3O/c1-16(2)14(18)8-10-17-9-4-5-11-12(15)6-3-7-13(11)17/h3,6-7H,4-5,8-10,15H2,1-2H3 |
| InChIKey | KXQDMJXISVUSMP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|