C15H21N3O — CID 61489284
2-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropyl-N-methylacetamide (PubChem CID 61489284) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropyl-N-methylacetamide.
| Compound Name | 2-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropyl-N-methylacetamide |
|---|---|
| PubChem CID | 61489284 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropyl-N-methylacetamide |
| SMILES | CN(C(=O)CN1CCCc2c(N)cccc21)C1CC1 |
| InChI | InChI=1S/C15H21N3O/c1-17(11-7-8-11)15(19)10-18-9-3-4-12-13(16)5-2-6-14(12)18/h2,5-6,11H,3-4,7-10,16H2,1H3 |
| InChIKey | YFTZMQNYRRVSDN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|