C14H20N2 — CID 115103996
4-(piperidin-1-ylmethyl)-2,3-dihydro-1H-indole (PubChem CID 115103996) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 4-(piperidin-1-ylmethyl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(piperidin-1-ylmethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115103996 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 4-(piperidin-1-ylmethyl)-2,3-dihydro-1H-indole |
| SMILES | c1cc(CN2CCCCC2)c2c(c1)NCC2 |
| InChI | InChI=1S/C14H20N2/c1-2-9-16(10-3-1)11-12-5-4-6-14-13(12)7-8-15-14/h4-6,15H,1-3,7-11H2 |
| InChIKey | FHFSNCMVUWUYDS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |