C16H24N2 — CID 115104102
8-(azepan-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 115104102) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 8-(azepan-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-(azepan-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 115104102 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 8-(azepan-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1cc2c(c(CN3CCCCCC3)c1)CNCC2 |
| InChI | InChI=1S/C16H24N2/c1-2-4-11-18(10-3-1)13-15-7-5-6-14-8-9-17-12-16(14)15/h5-7,17H,1-4,8-13H2 |
| InChIKey | FDHHCIUAMLRZLU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |