C16H21NO5 — CID 20820175
ethyl 3-[5-(methoxymethoxy)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropanoate (PubChem CID 20820175) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 3-[5-(methoxymethoxy)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[5-(methoxymethoxy)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 20820175 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl 3-[5-(methoxymethoxy)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N1CCCc2c(OCOC)cccc21 |
| InChI | InChI=1S/C16H21NO5/c1-3-21-16(19)10-15(18)17-9-5-6-12-13(17)7-4-8-14(12)22-11-20-2/h4,7-8H,3,5-6,9-11H2,1-2H3 |
| InChIKey | GLQDPKKELGPIMV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|