2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid

C12H15NO3 — CID 121202435

IUPAC2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid
SMILESCCOc1cccc2c1CCN2CC(=O)O
InChIInChI=1S/C12H15NO3/c1-2-16-11-5-3-4-10-9(11)6-7-13(10)8-12(14)15/h3-5H,2,6-8H2,1H3,(H,14,15)
InChIKeyPXIXTDMPEMGRNK-UHFFFAOYSA-N
MW221.26 g/mol
LogP1.53
Rot. Bonds4

About 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid

2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid (PubChem CID 121202435) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid
PubChem CID121202435
Molecular FormulaC12H15NO3
Molecular Weight221.26 g/mol
Exact Mass221.11
IUPAC Name2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid
SMILESCCOc1cccc2c1CCN2CC(=O)O
InChIInChI=1S/C12H15NO3/c1-2-16-11-5-3-4-10-9(11)6-7-13(10)8-12(14)15/h3-5H,2,6-8H2,1H3,(H,14,15)
InChIKeyPXIXTDMPEMGRNK-UHFFFAOYSA-N
XLogP1.53
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.26
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid?
The IUPAC name of 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid (CID 121202435) is 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid.
What is the SMILES notation for 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid?
The canonical SMILES for 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid is CCOc1cccc2c1CCN2CC(=O)O.
What is the InChIKey of 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid?
The InChIKey is PXIXTDMPEMGRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-2-16-11-5-3-4-10-9(11)6-7-13(10)8-12(14)15/h3-5H,2,6-8H2,1H3,(H,14,15).
What are the key properties of 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid?
2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid has a molecular weight of 221.26 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid is sourced from PubChem (CID 121202435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).