C12H15NO3 — CID 121202435
2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid (PubChem CID 121202435) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid.
| Compound Name | 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid |
|---|---|
| PubChem CID | 121202435 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(4-ethoxy-2,3-dihydroindol-1-yl)acetic acid |
| SMILES | CCOc1cccc2c1CCN2CC(=O)O |
| InChI | InChI=1S/C12H15NO3/c1-2-16-11-5-3-4-10-9(11)6-7-13(10)8-12(14)15/h3-5H,2,6-8H2,1H3,(H,14,15) |
| InChIKey | PXIXTDMPEMGRNK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |