C12H14NO4- — CID 18351856
2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate (PubChem CID 18351856) has the molecular formula C12H14NO4- and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate.
| Compound Name | 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate |
|---|---|
| PubChem CID | 18351856 |
| Molecular Formula | C12H14NO4- |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate |
| SMILES | O=C([O-])COc1cccc2c1CCN2CCO |
| InChI | InChI=1S/C12H15NO4/c14-7-6-13-5-4-9-10(13)2-1-3-11(9)17-8-12(15)16/h1-3,14H,4-8H2,(H,15,16)/p-1 |
| InChIKey | RUAOKSSYUWNVDO-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |