About 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate
2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate (PubChem CID 18351856) has the molecular formula C12H14NO4-
and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate.
Molecular Properties
| Compound Name | 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate |
| PubChem CID | 18351856 |
| Molecular Formula | C12H14NO4- |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate |
| SMILES | O=C([O-])COc1cccc2c1CCN2CCO |
| InChI | InChI=1S/C12H15NO4/c14-7-6-13-5-4-9-10(13)2-1-3-11(9)17-8-12(15)16/h1-3,14H,4-8H2,(H,15,16)/p-1 |
| InChIKey | RUAOKSSYUWNVDO-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate?
The IUPAC name of 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate (CID 18351856) is 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate.
What is the SMILES notation for 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate?
The canonical SMILES for 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate is O=C([O-])COc1cccc2c1CCN2CCO.
What is the InChIKey of 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate?
The InChIKey is RUAOKSSYUWNVDO-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H15NO4/c14-7-6-13-5-4-9-10(13)2-1-3-11(9)17-8-12(15)16/h1-3,14H,4-8H2,(H,15,16)/p-1.
What are the key properties of 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate?
2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate has a molecular weight of 236.25 g/mol, XLogP of -0.83, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2-hydroxyethyl)-2,3-dihydroindol-4-yl]oxy]acetate is sourced from PubChem (CID 18351856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).